C41H45N5O7 — CID 170703922
N-hydroxy-1-[2-[3-[[9-[2-[(3S)-6-hydroxy-2-oxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]non-8-ynoyl-methylamino]methyl]phenoxy]ethyl]indole-6-carboxamide (PubChem CID 170703922) has the molecular formula C41H45N5O7 and a molecular weight of 719.84 g/mol. Its IUPAC name is N-hydroxy-1-[2-[3-[[9-[2-[(3S)-6-hydroxy-2-oxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]non-8-ynoyl-methylamino]methyl]phenoxy]ethyl]indole-6-carboxamide.
| Compound Name | N-hydroxy-1-[2-[3-[[9-[2-[(3S)-6-hydroxy-2-oxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]non-8-ynoyl-methylamino]methyl]phenoxy]ethyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 170703922 |
| Molecular Formula | C41H45N5O7 |
| Molecular Weight | 719.84 g/mol |
| Exact Mass | 719.33 |
| IUPAC Name | N-hydroxy-1-[2-[3-[[9-[2-[(3S)-6-hydroxy-2-oxopiperidin-3-yl]-1-oxo-3H-isoindol-5-yl]non-8-ynoyl-methylamino]methyl]phenoxy]ethyl]indole-6-carboxamide |
| SMILES | CN(Cc1cccc(OCCn2ccc3ccc(C(=O)NO)cc32)c1)C(=O)CCCCCCC#Cc1ccc2c(c1)CN([C@H]1CCC(O)NC1=O)C2=O |
| InChI | InChI=1S/C41H45N5O7/c1-44(26-29-10-8-11-33(24-29)53-22-21-45-20-19-30-14-15-31(25-36(30)45)39(49)43-52)38(48)12-7-5-3-2-4-6-9-28-13-16-34-32(23-28)27-46(41(34)51)35-17-18-37(47)42-40(35)50/h8,10-11,13-16,19-20,23-25,35,37,47,52H,2-5,7,12,17-18,21-22,26-27H2,1H3,(H,42,50)(H,43,49)/t35-,37?/m0/s1 |
| InChIKey | UWSPZPYPDFZMMQ-FXGUBZCASA-N |
| XLogP | 4.74 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|