C28H28FNO3 — CID 87267068
N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxopentanamide (PubChem CID 87267068) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxopentanamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxopentanamide |
|---|---|
| PubChem CID | 87267068 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxopentanamide |
| SMILES | Cc1ccc(NC(=O)C(C(=O)C(C)C)C(C(=O)c2ccc(F)cc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H28FNO3/c1-17(2)26(31)25(28(33)30-23-15-10-18(3)16-19(23)4)24(20-8-6-5-7-9-20)27(32)21-11-13-22(29)14-12-21/h5-17,24-25H,1-4H3,(H,30,33) |
| InChIKey | ABRNNRUTBPBHSA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|