C53H49F2NO6 — CID 161098700
2-[2-(3,4-difluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;5-methyl-1,2-diphenyl-3-(2-phenylacetyl)hexane-1,4-dione (PubChem CID 161098700) has the molecular formula C53H49F2NO6 and a molecular weight of 833.97 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;5-methyl-1,2-diphenyl-3-(2-phenylacetyl)hexane-1,4-dione.
| Compound Name | 2-[2-(3,4-difluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;5-methyl-1,2-diphenyl-3-(2-phenylacetyl)hexane-1,4-dione |
|---|---|
| PubChem CID | 161098700 |
| Molecular Formula | C53H49F2NO6 |
| Molecular Weight | 833.97 g/mol |
| Exact Mass | 833.35 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;5-methyl-1,2-diphenyl-3-(2-phenylacetyl)hexane-1,4-dione |
| SMILES | CC(C)C(=O)C(C(=O)Cc1ccccc1)C(C(=O)c1ccccc1)c1ccccc1.CC(C)C(=O)C(C(=O)Nc1ccccc1)C(C(=O)c1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C27H26O3.C26H23F2NO3/c1-19(2)26(29)25(23(28)18-20-12-6-3-7-13-20)24(21-14-8-4-9-15-21)27(30)22-16-10-5-11-17-22;1-16(2)24(30)23(26(32)29-19-11-7-4-8-12-19)22(17-9-5-3-6-10-17)25(31)18-13-14-20(27)21(28)15-18/h3-17,19,24-25H,18H2,1-2H3;3-16,22-23H,1-2H3,(H,29,32) |
| InChIKey | UIDGZINWLDNLMP-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.97 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|