C52H49FN2O6 — CID 159416440
2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;4-methyl-3-oxo-2-(2-oxo-1,2-diphenylethyl)-N-phenylpentanamide (PubChem CID 159416440) has the molecular formula C52H49FN2O6 and a molecular weight of 816.97 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;4-methyl-3-oxo-2-(2-oxo-1,2-diphenylethyl)-N-phenylpentanamide.
| Compound Name | 2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;4-methyl-3-oxo-2-(2-oxo-1,2-diphenylethyl)-N-phenylpentanamide |
|---|---|
| PubChem CID | 159416440 |
| Molecular Formula | C52H49FN2O6 |
| Molecular Weight | 816.97 g/mol |
| Exact Mass | 816.36 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide;4-methyl-3-oxo-2-(2-oxo-1,2-diphenylethyl)-N-phenylpentanamide |
| SMILES | CC(C)C(=O)C(C(=O)Nc1ccccc1)C(C(=O)c1ccc(F)cc1)c1ccccc1.CC(C)C(=O)C(C(=O)Nc1ccccc1)C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24FNO3.C26H25NO3/c1-17(2)24(29)23(26(31)28-21-11-7-4-8-12-21)22(18-9-5-3-6-10-18)25(30)19-13-15-20(27)16-14-19;1-18(2)24(28)23(26(30)27-21-16-10-5-11-17-21)22(19-12-6-3-7-13-19)25(29)20-14-8-4-9-15-20/h3-17,22-23H,1-2H3,(H,28,31);3-18,22-23H,1-2H3,(H,27,30) |
| InChIKey | LPFJJFKUJUIYQV-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.97 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|