C30H34FNO2S2 — CID 11283864
2-[2,2-bis(ethylsulfanyl)-2-(4-fluorophenyl)-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide (PubChem CID 11283864) has the molecular formula C30H34FNO2S2 and a molecular weight of 523.74 g/mol. Its IUPAC name is 2-[2,2-bis(ethylsulfanyl)-2-(4-fluorophenyl)-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide.
| Compound Name | 2-[2,2-bis(ethylsulfanyl)-2-(4-fluorophenyl)-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 11283864 |
| Molecular Formula | C30H34FNO2S2 |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-[2,2-bis(ethylsulfanyl)-2-(4-fluorophenyl)-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide |
| SMILES | CCSC(SCC)(c1ccc(F)cc1)C(c1ccccc1)C(C(=O)Nc1ccccc1)C(=O)C(C)C |
| InChI | InChI=1S/C30H34FNO2S2/c1-5-35-30(36-6-2,23-17-19-24(31)20-18-23)27(22-13-9-7-10-14-22)26(28(33)21(3)4)29(34)32-25-15-11-8-12-16-25/h7-21,26-27H,5-6H2,1-4H3,(H,32,34) |
| InChIKey | URGNPYNQCQHLPD-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|