C26H26FNO3 — CID 163978424
2-[2-(4-fluorocyclohexa-1,5-dien-1-yl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide (PubChem CID 163978424) has the molecular formula C26H26FNO3 and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[2-(4-fluorocyclohexa-1,5-dien-1-yl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide.
| Compound Name | 2-[2-(4-fluorocyclohexa-1,5-dien-1-yl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 163978424 |
| Molecular Formula | C26H26FNO3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-[2-(4-fluorocyclohexa-1,5-dien-1-yl)-2-oxo-1-phenylethyl]-4-methyl-3-oxo-N-phenylpentanamide |
| SMILES | CC(C)C(=O)C(C(=O)Nc1ccccc1)C(C(=O)C1=CCC(F)C=C1)c1ccccc1 |
| InChI | InChI=1S/C26H26FNO3/c1-17(2)24(29)23(26(31)28-21-11-7-4-8-12-21)22(18-9-5-3-6-10-18)25(30)19-13-15-20(27)16-14-19/h3-15,17,20,22-23H,16H2,1-2H3,(H,28,31) |
| InChIKey | SWFJEQPMOGZHQV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|