C19H19NO2 — CID 174817728
4-methyl-3-oxo-N,2-diphenylhex-5-enamide (PubChem CID 174817728) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-methyl-3-oxo-N,2-diphenylhex-5-enamide.
| Compound Name | 4-methyl-3-oxo-N,2-diphenylhex-5-enamide |
|---|---|
| PubChem CID | 174817728 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-methyl-3-oxo-N,2-diphenylhex-5-enamide |
| SMILES | C=CC(C)C(=O)C(C(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c1-3-14(2)18(21)17(15-10-6-4-7-11-15)19(22)20-16-12-8-5-9-13-16/h3-14,17H,1H2,2H3,(H,20,22) |
| InChIKey | DWWXGURQLQFEQF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|