C19H15F2N2O+ — CID 162674646
N-(1-benzylpyridin-1-ium-4-yl)-3,4-difluorobenzamide (PubChem CID 162674646) has the molecular formula C19H15F2N2O+ and a molecular weight of 325.34 g/mol. Its IUPAC name is N-(1-benzylpyridin-1-ium-4-yl)-3,4-difluorobenzamide.
| Compound Name | N-(1-benzylpyridin-1-ium-4-yl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 162674646 |
| Molecular Formula | C19H15F2N2O+ |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-(1-benzylpyridin-1-ium-4-yl)-3,4-difluorobenzamide |
| SMILES | O=C(Nc1cc[n+](Cc2ccccc2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H14F2N2O/c20-17-7-6-15(12-18(17)21)19(24)22-16-8-10-23(11-9-16)13-14-4-2-1-3-5-14/h1-12H,13H2/p+1 |
| InChIKey | SSXPZWTWRLXXBF-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|