C20H17F4N3OS — CID 87267076
[3-[[(6-fluoro-1,3-benzothiazol-2-yl)amino]methyl]pyrrolidin-1-yl]-(3,4,5-trifluoro-2-methylphenyl)methanone (PubChem CID 87267076) has the molecular formula C20H17F4N3OS and a molecular weight of 423.44 g/mol. Its IUPAC name is [3-[[(6-fluoro-1,3-benzothiazol-2-yl)amino]methyl]pyrrolidin-1-yl]-(3,4,5-trifluoro-2-methylphenyl)methanone.
| Compound Name | [3-[[(6-fluoro-1,3-benzothiazol-2-yl)amino]methyl]pyrrolidin-1-yl]-(3,4,5-trifluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 87267076 |
| Molecular Formula | C20H17F4N3OS |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [3-[[(6-fluoro-1,3-benzothiazol-2-yl)amino]methyl]pyrrolidin-1-yl]-(3,4,5-trifluoro-2-methylphenyl)methanone |
| SMILES | Cc1c(C(=O)N2CCC(CNc3nc4ccc(F)cc4s3)C2)cc(F)c(F)c1F |
| InChI | InChI=1S/C20H17F4N3OS/c1-10-13(7-14(22)18(24)17(10)23)19(28)27-5-4-11(9-27)8-25-20-26-15-3-2-12(21)6-16(15)29-20/h2-3,6-7,11H,4-5,8-9H2,1H3,(H,25,26) |
| InChIKey | IJPIJLSTTQYDGQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|