C10H14O2 — CID 87267280
ethene;3-ethenyl-2-methylpenta-2,4-dienoic acid (PubChem CID 87267280) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is ethene;3-ethenyl-2-methylpenta-2,4-dienoic acid.
| Compound Name | ethene;3-ethenyl-2-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 87267280 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | ethene;3-ethenyl-2-methylpenta-2,4-dienoic acid |
| SMILES | C=C.C=CC(C=C)=C(C)C(=O)O |
| InChI | InChI=1S/C8H10O2.C2H4/c1-4-7(5-2)6(3)8(9)10;1-2/h4-5H,1-2H2,3H3,(H,9,10);1-2H2 |
| InChIKey | IXVZECFQDKTEGR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|