C14H14F3NO5 — CID 87269894
3-methoxy-4-methyl-2-(3-oxobutanoylamino)-6-(trifluoromethyl)benzoic acid (PubChem CID 87269894) has the molecular formula C14H14F3NO5 and a molecular weight of 333.26 g/mol. Its IUPAC name is 3-methoxy-4-methyl-2-(3-oxobutanoylamino)-6-(trifluoromethyl)benzoic acid.
| Compound Name | 3-methoxy-4-methyl-2-(3-oxobutanoylamino)-6-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 87269894 |
| Molecular Formula | C14H14F3NO5 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-methoxy-4-methyl-2-(3-oxobutanoylamino)-6-(trifluoromethyl)benzoic acid |
| SMILES | COc1c(C)cc(C(F)(F)F)c(C(=O)O)c1NC(=O)CC(C)=O |
| InChI | InChI=1S/C14H14F3NO5/c1-6-4-8(14(15,16)17)10(13(21)22)11(12(6)23-3)18-9(20)5-7(2)19/h4H,5H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | YPYWPIFQJMBUMH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|