About 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium
1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium (PubChem CID 87270022) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium.
Molecular Properties
| Compound Name | 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium |
| PubChem CID | 87270022 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium |
| SMILES | CCCCC[N+]1([O-])CCN=N1 |
| InChI | InChI=1S/C7H15N3O/c1-2-3-4-6-10(11)7-5-8-9-10/h2-7H2,1H3 |
| InChIKey | WKPMHSYMOWOTSB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium?
The IUPAC name of 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium (CID 87270022) is 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium.
What is the SMILES notation for 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium?
The canonical SMILES for 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium is CCCCC[N+]1([O-])CCN=N1.
What is the InChIKey of 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium?
The InChIKey is WKPMHSYMOWOTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-2-3-4-6-10(11)7-5-8-9-10/h2-7H2,1H3.
What are the key properties of 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium?
1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium has a molecular weight of 157.22 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-1-pentyl-4,5-dihydrotriazol-1-ium is sourced from PubChem (CID 87270022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).