C16H11Cl2N5O3 — CID 87270427
[1-(3-chlorophenyl)-3-[(6-chloropyridine-3-carbonyl)amino]pyrazol-4-yl]carbamic acid (PubChem CID 87270427) has the molecular formula C16H11Cl2N5O3 and a molecular weight of 392.20 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-3-[(6-chloropyridine-3-carbonyl)amino]pyrazol-4-yl]carbamic acid.
| Compound Name | [1-(3-chlorophenyl)-3-[(6-chloropyridine-3-carbonyl)amino]pyrazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 87270427 |
| Molecular Formula | C16H11Cl2N5O3 |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | [1-(3-chlorophenyl)-3-[(6-chloropyridine-3-carbonyl)amino]pyrazol-4-yl]carbamic acid |
| SMILES | O=C(O)Nc1cn(-c2cccc(Cl)c2)nc1NC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H11Cl2N5O3/c17-10-2-1-3-11(6-10)23-8-12(20-16(25)26)14(22-23)21-15(24)9-4-5-13(18)19-7-9/h1-8,20H,(H,25,26)(H,21,22,24) |
| InChIKey | FDYBQSKVJHWIQG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|