C24H27N5O3S2 — CID 87277374
2-(5,7-dimethyl-4,6-dioxo-[1,2]thiazolo[5,4-d]pyrimidin-3-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 87277374) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-(5,7-dimethyl-4,6-dioxo-[1,2]thiazolo[5,4-d]pyrimidin-3-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5,7-dimethyl-4,6-dioxo-[1,2]thiazolo[5,4-d]pyrimidin-3-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87277374 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-(5,7-dimethyl-4,6-dioxo-[1,2]thiazolo[5,4-d]pyrimidin-3-yl)-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCCc1ccc(-c2csc(NC(=O)Cc3nsc4c3c(=O)n(C)c(=O)n4C)n2)cc1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-4-5-6-7-8-15-9-11-16(12-10-15)18-14-33-23(25-18)26-19(30)13-17-20-21(31)28(2)24(32)29(3)22(20)34-27-17/h9-12,14H,4-8,13H2,1-3H3,(H,25,26,30) |
| InChIKey | BPYHPPYDMWLZLB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|