C37H36F3N3O6 — CID 87278766
[(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-phenylmethoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate (PubChem CID 87278766) has the molecular formula C37H36F3N3O6 and a molecular weight of 675.70 g/mol. Its IUPAC name is [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-phenylmethoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-phenylmethoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87278766 |
| Molecular Formula | C37H36F3N3O6 |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.26 |
| IUPAC Name | [(3R)-1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-(6-phenylmethoxy-3-pyridinyl)acetate;2,2,2-trifluoroacetate |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C(Nc1ccccc1)c1ccc(OCc3ccccc3)nc1)C2)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C35H36N3O4.C2HF3O2/c39-31(27-12-6-2-7-13-27)23-38-20-18-28(19-21-38)32(24-38)42-35(40)34(37-30-14-8-3-9-15-30)29-16-17-33(36-22-29)41-25-26-10-4-1-5-11-26;3-2(4,5)1(6)7/h1-17,22,28,32,34,37H,18-21,23-25H2;(H,6,7)/q+1;/p-1/t28?,32-,34?,38?;/m0./s1 |
| InChIKey | RYYAZFGGZOYETQ-JHNLBMBESA-M |
| XLogP | 5.15 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|