C16H18N4O3 — CID 872796
1-[(2S,3S)-3-(3-nitrophenyl)-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]ethanone (PubChem CID 872796) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-[(2S,3S)-3-(3-nitrophenyl)-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]ethanone.
| Compound Name | 1-[(2S,3S)-3-(3-nitrophenyl)-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]ethanone |
|---|---|
| PubChem CID | 872796 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[(2S,3S)-3-(3-nitrophenyl)-1,4,5-triazatricyclo[5.2.2.02,6]undec-5-en-4-yl]ethanone |
| SMILES | CC(=O)N1N=C2C3CCN(CC3)[C@H]2[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H18N4O3/c1-10(21)19-15(12-3-2-4-13(9-12)20(22)23)16-14(17-19)11-5-7-18(16)8-6-11/h2-4,9,11,15-16H,5-8H2,1H3/t15-,16+/m0/s1 |
| InChIKey | QMRWUEGSQCBNKA-JKSUJKDBSA-N |
| XLogP | 1.95 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|