C24H25N5O5 — CID 2828281
1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-5-propyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]ethanone (PubChem CID 2828281) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is 1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-5-propyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]ethanone.
| Compound Name | 1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-5-propyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]ethanone |
|---|---|
| PubChem CID | 2828281 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-[3-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-5-propyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]ethanone |
| SMILES | CCCN1CC(=Cc2cccc([N+](=O)[O-])c2)C2=NN(C(C)=O)C(c3cccc([N+](=O)[O-])c3)C2C1 |
| InChI | InChI=1S/C24H25N5O5/c1-3-10-26-14-19(11-17-6-4-8-20(12-17)28(31)32)23-22(15-26)24(27(25-23)16(2)30)18-7-5-9-21(13-18)29(33)34/h4-9,11-13,22,24H,3,10,14-15H2,1-2H3 |
| InChIKey | IQEVABMKEFLFJY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 122.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|