C30H25Cl2N3O3 — CID 3668911
1-[3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 3668911) has the molecular formula C30H25Cl2N3O3 and a molecular weight of 546.45 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 1-[3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3668911 |
| Molecular Formula | C30H25Cl2N3O3 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-3-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | CC1CC(=Cc2ccc(Cl)cc2)C2=NN(C(=O)C=Cc3cccc([N+](=O)[O-])c3)C(c3ccc(Cl)cc3)C2C1 |
| InChI | InChI=1S/C30H25Cl2N3O3/c1-19-15-23(17-21-5-10-24(31)11-6-21)29-27(16-19)30(22-8-12-25(32)13-9-22)34(33-29)28(36)14-7-20-3-2-4-26(18-20)35(37)38/h2-14,17-19,27,30H,15-16H2,1H3 |
| InChIKey | TYZTVRJMCYQKFN-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|