C28H22Cl2N4O5 — CID 124773746
[(3S,3aR,5S,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,4-dinitrophenyl)methanone (PubChem CID 124773746) has the molecular formula C28H22Cl2N4O5 and a molecular weight of 565.41 g/mol. Its IUPAC name is [(3S,3aR,5S,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,4-dinitrophenyl)methanone.
| Compound Name | [(3S,3aR,5S,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,4-dinitrophenyl)methanone |
|---|---|
| PubChem CID | 124773746 |
| Molecular Formula | C28H22Cl2N4O5 |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | [(3S,3aR,5S,7E)-3-(4-chlorophenyl)-7-[(4-chlorophenyl)methylidene]-5-methyl-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(2,4-dinitrophenyl)methanone |
| SMILES | C[C@@H]1C/C(=C\c2ccc(Cl)cc2)C2=NN(C(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])[C@H](c3ccc(Cl)cc3)[C@H]2C1 |
| InChI | InChI=1S/C28H22Cl2N4O5/c1-16-12-19(14-17-2-6-20(29)7-3-17)26-24(13-16)27(18-4-8-21(30)9-5-18)32(31-26)28(35)23-11-10-22(33(36)37)15-25(23)34(38)39/h2-11,14-16,24,27H,12-13H2,1H3/b19-14+/t16-,24+,27-/m1/s1 |
| InChIKey | NBKGSHHTNLCTFW-ZHICHNDXSA-N |
| XLogP | 7.49 |
| TPSA | 118.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|