C14H32O4 — CID 87279877
2,2-dimethylpropane-1,3-diol;4-methyloctane-3,3-diol (PubChem CID 87279877) has the molecular formula C14H32O4 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;4-methyloctane-3,3-diol.
| Compound Name | 2,2-dimethylpropane-1,3-diol;4-methyloctane-3,3-diol |
|---|---|
| PubChem CID | 87279877 |
| Molecular Formula | C14H32O4 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 2,2-dimethylpropane-1,3-diol;4-methyloctane-3,3-diol |
| SMILES | CC(C)(CO)CO.CCCCC(C)C(O)(O)CC |
| InChI | InChI=1S/C9H20O2.C5H12O2/c1-4-6-7-8(3)9(10,11)5-2;1-5(2,3-6)4-7/h8,10-11H,4-7H2,1-3H3;6-7H,3-4H2,1-2H3 |
| InChIKey | OCEIPRWOIMOFHF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|