About ethyl formate;methyl N-pyrazol-1-ylcarbamate
ethyl formate;methyl N-pyrazol-1-ylcarbamate (PubChem CID 87280485) has the molecular formula C8H13N3O4
and a molecular weight of 215.21 g/mol. Its IUPAC name is ethyl formate;methyl N-pyrazol-1-ylcarbamate.
Molecular Properties
| Compound Name | ethyl formate;methyl N-pyrazol-1-ylcarbamate |
| PubChem CID | 87280485 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | ethyl formate;methyl N-pyrazol-1-ylcarbamate |
| SMILES | CCOC=O.COC(=O)Nn1cccn1 |
| InChI | InChI=1S/C5H7N3O2.C3H6O2/c1-10-5(9)7-8-4-2-3-6-8;1-2-5-3-4/h2-4H,1H3,(H,7,9);3H,2H2,1H3 |
| InChIKey | JTEYWZZDCYHSKI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;methyl N-pyrazol-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;methyl N-pyrazol-1-ylcarbamate?
The IUPAC name of ethyl formate;methyl N-pyrazol-1-ylcarbamate (CID 87280485) is ethyl formate;methyl N-pyrazol-1-ylcarbamate.
What is the SMILES notation for ethyl formate;methyl N-pyrazol-1-ylcarbamate?
The canonical SMILES for ethyl formate;methyl N-pyrazol-1-ylcarbamate is CCOC=O.COC(=O)Nn1cccn1.
What is the InChIKey of ethyl formate;methyl N-pyrazol-1-ylcarbamate?
The InChIKey is JTEYWZZDCYHSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2.C3H6O2/c1-10-5(9)7-8-4-2-3-6-8;1-2-5-3-4/h2-4H,1H3,(H,7,9);3H,2H2,1H3.
What are the key properties of ethyl formate;methyl N-pyrazol-1-ylcarbamate?
ethyl formate;methyl N-pyrazol-1-ylcarbamate has a molecular weight of 215.21 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;methyl N-pyrazol-1-ylcarbamate is sourced from PubChem (CID 87280485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).