C23H22N6O2 — CID 87281910
N-[(1-benzyltriazol-4-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide (PubChem CID 87281910) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[(1-benzyltriazol-4-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide.
| Compound Name | N-[(1-benzyltriazol-4-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 87281910 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(1-benzyltriazol-4-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
| SMILES | O=C(NOCc1cn(Cc2ccccc2)nn1)c1ccccc1NCc1ccncc1 |
| InChI | InChI=1S/C23H22N6O2/c30-23(21-8-4-5-9-22(21)25-14-18-10-12-24-13-11-18)27-31-17-20-16-29(28-26-20)15-19-6-2-1-3-7-19/h1-13,16,25H,14-15,17H2,(H,27,30) |
| InChIKey | URXOBPMLOKLLFO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|