C25H29N3O3 — CID 58989953
N-[(4-pentoxyphenyl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide (PubChem CID 58989953) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[(4-pentoxyphenyl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide.
| Compound Name | N-[(4-pentoxyphenyl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 58989953 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[(4-pentoxyphenyl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
| SMILES | CCCCCOc1ccc(CONC(=O)c2ccccc2NCc2ccncc2)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-3-6-17-30-22-11-9-21(10-12-22)19-31-28-25(29)23-7-4-5-8-24(23)27-18-20-13-15-26-16-14-20/h4-5,7-16,27H,2-3,6,17-19H2,1H3,(H,28,29) |
| InChIKey | SZSHGCJPSSJZFQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|