C26H28N4O3 — CID 88918465
N-[[4-(1-morpholin-4-ylethenyl)phenyl]methoxy]-2-(pyridin-4-ylmethylamino)benzamide (PubChem CID 88918465) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[[4-(1-morpholin-4-ylethenyl)phenyl]methoxy]-2-(pyridin-4-ylmethylamino)benzamide.
| Compound Name | N-[[4-(1-morpholin-4-ylethenyl)phenyl]methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 88918465 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[[4-(1-morpholin-4-ylethenyl)phenyl]methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
| SMILES | C=C(c1ccc(CONC(=O)c2ccccc2NCc2ccncc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H28N4O3/c1-20(30-14-16-32-17-15-30)23-8-6-22(7-9-23)19-33-29-26(31)24-4-2-3-5-25(24)28-18-21-10-12-27-13-11-21/h2-13,28H,1,14-19H2,(H,29,31) |
| InChIKey | DBCRWTQSCFZEDE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|