C21H26N4O3 — CID 91581577
N-[(3-butyl-2,5-dihydro-1,2-oxazol-5-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide (PubChem CID 91581577) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[(3-butyl-2,5-dihydro-1,2-oxazol-5-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide.
| Compound Name | N-[(3-butyl-2,5-dihydro-1,2-oxazol-5-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 91581577 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[(3-butyl-2,5-dihydro-1,2-oxazol-5-yl)methoxy]-2-(pyridin-4-ylmethylamino)benzamide |
| SMILES | CCCCC1=CC(CONC(=O)c2ccccc2NCc2ccncc2)ON1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-3-6-17-13-18(28-24-17)15-27-25-21(26)19-7-4-5-8-20(19)23-14-16-9-11-22-12-10-16/h4-5,7-13,18,23-24H,2-3,6,14-15H2,1H3,(H,25,26) |
| InChIKey | FIJJTJUEYZXBRQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|