C23H26N4O3 — CID 91317046
N-[(4-cyanophenyl)methoxy]-2-[2-(3-propyl-2,5-dihydro-1,2-oxazol-5-yl)ethylamino]benzamide (PubChem CID 91317046) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methoxy]-2-[2-(3-propyl-2,5-dihydro-1,2-oxazol-5-yl)ethylamino]benzamide.
| Compound Name | N-[(4-cyanophenyl)methoxy]-2-[2-(3-propyl-2,5-dihydro-1,2-oxazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 91317046 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[(4-cyanophenyl)methoxy]-2-[2-(3-propyl-2,5-dihydro-1,2-oxazol-5-yl)ethylamino]benzamide |
| SMILES | CCCC1=CC(CCNc2ccccc2C(=O)NOCc2ccc(C#N)cc2)ON1 |
| InChI | InChI=1S/C23H26N4O3/c1-2-5-19-14-20(30-26-19)12-13-25-22-7-4-3-6-21(22)23(28)27-29-16-18-10-8-17(15-24)9-11-18/h3-4,6-11,14,20,25-26H,2,5,12-13,16H2,1H3,(H,27,28) |
| InChIKey | POCRHJWTTIAUAA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|