C20H20N4O3 — CID 91189928
N-[(4-cyanophenyl)methoxy]-2-[(3-methyl-2,5-dihydro-1,2-oxazol-5-yl)methylamino]benzamide (PubChem CID 91189928) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methoxy]-2-[(3-methyl-2,5-dihydro-1,2-oxazol-5-yl)methylamino]benzamide.
| Compound Name | N-[(4-cyanophenyl)methoxy]-2-[(3-methyl-2,5-dihydro-1,2-oxazol-5-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 91189928 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[(4-cyanophenyl)methoxy]-2-[(3-methyl-2,5-dihydro-1,2-oxazol-5-yl)methylamino]benzamide |
| SMILES | CC1=CC(CNc2ccccc2C(=O)NOCc2ccc(C#N)cc2)ON1 |
| InChI | InChI=1S/C20H20N4O3/c1-14-10-17(27-23-14)12-22-19-5-3-2-4-18(19)20(25)24-26-13-16-8-6-15(11-21)7-9-16/h2-10,17,22-23H,12-13H2,1H3,(H,24,25) |
| InChIKey | GFGBLJFRKLMOBK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|