4,5-diamino-2-chloro-3-ethylbenzoic acid

C9H11ClN2O2 — CID 87283110

IUPAC4,5-diamino-2-chloro-3-ethylbenzoic acid
SMILESCCc1c(N)c(N)cc(C(=O)O)c1Cl
InChIInChI=1S/C9H11ClN2O2/c1-2-4-7(10)5(9(13)14)3-6(11)8(4)12/h3H,2,11-12H2,1H3,(H,13,14)
InChIKeyRPBZBVHQFVEDIF-UHFFFAOYSA-N
MW214.65 g/mol
LogP1.76
Rot. Bonds2

About 4,5-diamino-2-chloro-3-ethylbenzoic acid

4,5-diamino-2-chloro-3-ethylbenzoic acid (PubChem CID 87283110) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 4,5-diamino-2-chloro-3-ethylbenzoic acid.

Molecular Properties

Compound Name4,5-diamino-2-chloro-3-ethylbenzoic acid
PubChem CID87283110
Molecular FormulaC9H11ClN2O2
Molecular Weight214.65 g/mol
Exact Mass214.05
IUPAC Name4,5-diamino-2-chloro-3-ethylbenzoic acid
SMILESCCc1c(N)c(N)cc(C(=O)O)c1Cl
InChIInChI=1S/C9H11ClN2O2/c1-2-4-7(10)5(9(13)14)3-6(11)8(4)12/h3H,2,11-12H2,1H3,(H,13,14)
InChIKeyRPBZBVHQFVEDIF-UHFFFAOYSA-N
XLogP1.76
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.65
LogP ≤ 51.76
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4,5-diamino-2-chloro-3-ethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-diamino-2-chloro-3-ethylbenzoic acid?
The IUPAC name of 4,5-diamino-2-chloro-3-ethylbenzoic acid (CID 87283110) is 4,5-diamino-2-chloro-3-ethylbenzoic acid.
What is the SMILES notation for 4,5-diamino-2-chloro-3-ethylbenzoic acid?
The canonical SMILES for 4,5-diamino-2-chloro-3-ethylbenzoic acid is CCc1c(N)c(N)cc(C(=O)O)c1Cl.
What is the InChIKey of 4,5-diamino-2-chloro-3-ethylbenzoic acid?
The InChIKey is RPBZBVHQFVEDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O2/c1-2-4-7(10)5(9(13)14)3-6(11)8(4)12/h3H,2,11-12H2,1H3,(H,13,14).
What are the key properties of 4,5-diamino-2-chloro-3-ethylbenzoic acid?
4,5-diamino-2-chloro-3-ethylbenzoic acid has a molecular weight of 214.65 g/mol, XLogP of 1.76, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diamino-2-chloro-3-ethylbenzoic acid is sourced from PubChem (CID 87283110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).