C20H25ClN4O3 — CID 87283784
[2-[1-(6-chloroquinolin-2-yl)piperidin-4-yl]-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid (PubChem CID 87283784) has the molecular formula C20H25ClN4O3 and a molecular weight of 404.90 g/mol. Its IUPAC name is [2-[1-(6-chloroquinolin-2-yl)piperidin-4-yl]-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid.
| Compound Name | [2-[1-(6-chloroquinolin-2-yl)piperidin-4-yl]-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid |
|---|---|
| PubChem CID | 87283784 |
| Molecular Formula | C20H25ClN4O3 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [2-[1-(6-chloroquinolin-2-yl)piperidin-4-yl]-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid |
| SMILES | CNC(CN(CC=O)C(=O)O)C1CCN(c2ccc3cc(Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C20H25ClN4O3/c1-22-18(13-25(10-11-26)20(27)28)14-6-8-24(9-7-14)19-5-2-15-12-16(21)3-4-17(15)23-19/h2-5,11-12,14,18,22H,6-10,13H2,1H3,(H,27,28) |
| InChIKey | DUNHZICIQKCRLY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|