C20H26N4O3 — CID 87283756
[2-(1-isoquinolin-3-ylpiperidin-4-yl)-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid (PubChem CID 87283756) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-(1-isoquinolin-3-ylpiperidin-4-yl)-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid.
| Compound Name | [2-(1-isoquinolin-3-ylpiperidin-4-yl)-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid |
|---|---|
| PubChem CID | 87283756 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | [2-(1-isoquinolin-3-ylpiperidin-4-yl)-2-(methylamino)ethyl]-(2-oxoethyl)carbamic acid |
| SMILES | CNC(CN(CC=O)C(=O)O)C1CCN(c2cc3ccccc3cn2)CC1 |
| InChI | InChI=1S/C20H26N4O3/c1-21-18(14-24(10-11-25)20(26)27)15-6-8-23(9-7-15)19-12-16-4-2-3-5-17(16)13-22-19/h2-5,11-13,15,18,21H,6-10,14H2,1H3,(H,26,27) |
| InChIKey | XICLMOWKQLABSW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|