C16H21F3N4O3 — CID 87283969
[2-amino-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid (PubChem CID 87283969) has the molecular formula C16H21F3N4O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is [2-amino-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid.
| Compound Name | [2-amino-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid |
|---|---|
| PubChem CID | 87283969 |
| Molecular Formula | C16H21F3N4O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-amino-2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid |
| SMILES | NC(CN(CC=O)C(=O)O)C1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H21F3N4O3/c17-16(18,19)12-1-2-14(21-9-12)22-5-3-11(4-6-22)13(20)10-23(7-8-24)15(25)26/h1-2,8-9,11,13H,3-7,10,20H2,(H,25,26) |
| InChIKey | VZQNQKYSBZPGKC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|