C19H27F3N4O — CID 87003728
1-(cyclopropylmethyl)-1-propyl-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea (PubChem CID 87003728) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-1-propyl-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea.
| Compound Name | 1-(cyclopropylmethyl)-1-propyl-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 87003728 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(cyclopropylmethyl)-1-propyl-3-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]urea |
| SMILES | CCCN(CC1CC1)C(=O)NC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C19H27F3N4O/c1-2-9-26(13-14-3-4-14)18(27)24-16-7-10-25(11-8-16)17-6-5-15(12-23-17)19(20,21)22/h5-6,12,14,16H,2-4,7-11,13H2,1H3,(H,24,27) |
| InChIKey | DGVGPGILSWSGRN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |