C21H26N4O3 — CID 87283728
[2-amino-2-[1-(3-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid (PubChem CID 87283728) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-amino-2-[1-(3-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid.
| Compound Name | [2-amino-2-[1-(3-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid |
|---|---|
| PubChem CID | 87283728 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [2-amino-2-[1-(3-phenyl-2-pyridinyl)piperidin-4-yl]ethyl]-(2-oxoethyl)carbamic acid |
| SMILES | NC(CN(CC=O)C(=O)O)C1CCN(c2ncccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c22-19(15-25(13-14-26)21(27)28)17-8-11-24(12-9-17)20-18(7-4-10-23-20)16-5-2-1-3-6-16/h1-7,10,14,17,19H,8-9,11-13,15,22H2,(H,27,28) |
| InChIKey | KURKEONSGVPHMV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|