C17H26N4O3 — CID 87283445
[2-(methylamino)-3-(4-phenylpiperazin-1-yl)propyl]-(2-oxoethyl)carbamic acid (PubChem CID 87283445) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is [2-(methylamino)-3-(4-phenylpiperazin-1-yl)propyl]-(2-oxoethyl)carbamic acid.
| Compound Name | [2-(methylamino)-3-(4-phenylpiperazin-1-yl)propyl]-(2-oxoethyl)carbamic acid |
|---|---|
| PubChem CID | 87283445 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [2-(methylamino)-3-(4-phenylpiperazin-1-yl)propyl]-(2-oxoethyl)carbamic acid |
| SMILES | CNC(CN1CCN(c2ccccc2)CC1)CN(CC=O)C(=O)O |
| InChI | InChI=1S/C17H26N4O3/c1-18-15(14-21(11-12-22)17(23)24)13-19-7-9-20(10-8-19)16-5-3-2-4-6-16/h2-6,12,15,18H,7-11,13-14H2,1H3,(H,23,24) |
| InChIKey | GUFBPLZZJUOYEL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|