About 2-tripentylsilylacetic acid
2-tripentylsilylacetic acid (PubChem CID 87284037) has the molecular formula C17H36O2Si
and a molecular weight of 300.56 g/mol. Its IUPAC name is 2-tripentylsilylacetic acid.
Molecular Properties
| Compound Name | 2-tripentylsilylacetic acid |
| PubChem CID | 87284037 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 2-tripentylsilylacetic acid |
| SMILES | CCCCC[Si](CCCCC)(CCCCC)CC(=O)O |
| InChI | InChI=1S/C17H36O2Si/c1-4-7-10-13-20(16-17(18)19,14-11-8-5-2)15-12-9-6-3/h4-16H2,1-3H3,(H,18,19) |
| InChIKey | CPPMSMODFOAHLJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tripentylsilylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tripentylsilylacetic acid?
The IUPAC name of 2-tripentylsilylacetic acid (CID 87284037) is 2-tripentylsilylacetic acid.
What is the SMILES notation for 2-tripentylsilylacetic acid?
The canonical SMILES for 2-tripentylsilylacetic acid is CCCCC[Si](CCCCC)(CCCCC)CC(=O)O.
What is the InChIKey of 2-tripentylsilylacetic acid?
The InChIKey is CPPMSMODFOAHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O2Si/c1-4-7-10-13-20(16-17(18)19,14-11-8-5-2)15-12-9-6-3/h4-16H2,1-3H3,(H,18,19).
What are the key properties of 2-tripentylsilylacetic acid?
2-tripentylsilylacetic acid has a molecular weight of 300.56 g/mol, XLogP of 6.09, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tripentylsilylacetic acid is sourced from PubChem (CID 87284037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).