(2R)-3-hydroxy-2-(methoxyamino)propanoic acid

C4H9NO4 — CID 87285376

IUPAC(2R)-3-hydroxy-2-(methoxyamino)propanoic acid
SMILESCON[C@H](CO)C(=O)O
InChIInChI=1S/C4H9NO4/c1-9-5-3(2-6)4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m1/s1
InChIKeyPHQWVQLFECQJJB-GSVOUGTGSA-N
MW135.12 g/mol
LogP-1.42
Rot. Bonds4

About (2R)-3-hydroxy-2-(methoxyamino)propanoic acid

(2R)-3-hydroxy-2-(methoxyamino)propanoic acid (PubChem CID 87285376) has the molecular formula C4H9NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-(methoxyamino)propanoic acid.

Molecular Properties

Compound Name(2R)-3-hydroxy-2-(methoxyamino)propanoic acid
PubChem CID87285376
Molecular FormulaC4H9NO4
Molecular Weight135.12 g/mol
Exact Mass135.05
IUPAC Name(2R)-3-hydroxy-2-(methoxyamino)propanoic acid
SMILESCON[C@H](CO)C(=O)O
InChIInChI=1S/C4H9NO4/c1-9-5-3(2-6)4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m1/s1
InChIKeyPHQWVQLFECQJJB-GSVOUGTGSA-N
XLogP-1.42
TPSA78.79 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.12
LogP ≤ 5-1.42
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2R)-3-hydroxy-2-(methoxyamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(methoxyamino)hexanoic acid
CID 103254320
(2S)-2-(methoxyamino)-4-methylsulfanylbutanoic acid
CID 154085553
3-hydroxy-2-(pentoxyamino)propanoic acid
CID 154790126
(2S)-2-(ethylamino)-3-hydroxypropanoic acid
CID 12003152
(2S)-2-[(4-amino-3-methoxybutanoyl)amino]-3-hydroxypropanoic acid
CID 103155444
(2R)-2-[bis(2-methoxyethyl)carbamoylamino]-3-hydroxypropanoic acid
CID 80755955
2-[(4-amino-3-methoxybutanoyl)amino]-3-hydroxypropanoic acid
CID 103155386
3-hydroxy-2-[(4-methoxy-4-oxobutanoyl)amino]propanoic acid
CID 101050675
3-hydroxy-2-(propanoylamino)propanoic acid
CID 11845678
2-acetamido-3-hydroxypropanoic acid;sulfane
CID 175323357
(2R)-3-hydroxy-2-[(1-methoxy-1-oxopropan-2-yl)carbamoylamino]propanoic acid
CID 80757457
3-hydroxy-2-(2-methylpropylamino)propanoic acid
CID 83635492

Frequently Asked Questions

What is the IUPAC name of (2R)-3-hydroxy-2-(methoxyamino)propanoic acid?
The IUPAC name of (2R)-3-hydroxy-2-(methoxyamino)propanoic acid (CID 87285376) is (2R)-3-hydroxy-2-(methoxyamino)propanoic acid.
What is the SMILES notation for (2R)-3-hydroxy-2-(methoxyamino)propanoic acid?
The canonical SMILES for (2R)-3-hydroxy-2-(methoxyamino)propanoic acid is CON[C@H](CO)C(=O)O.
What is the InChIKey of (2R)-3-hydroxy-2-(methoxyamino)propanoic acid?
The InChIKey is PHQWVQLFECQJJB-GSVOUGTGSA-N. The full InChI is InChI=1S/C4H9NO4/c1-9-5-3(2-6)4(7)8/h3,5-6H,2H2,1H3,(H,7,8)/t3-/m1/s1.
What are the key properties of (2R)-3-hydroxy-2-(methoxyamino)propanoic acid?
(2R)-3-hydroxy-2-(methoxyamino)propanoic acid has a molecular weight of 135.12 g/mol, XLogP of -1.42, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-hydroxy-2-(methoxyamino)propanoic acid is sourced from PubChem (CID 87285376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).