C17H14FNO3 — CID 87287953
methyl N-[1-(2-fluoro-2-oxoethyl)-9H-fluoren-9-yl]carbamate (PubChem CID 87287953) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is methyl N-[1-(2-fluoro-2-oxoethyl)-9H-fluoren-9-yl]carbamate.
| Compound Name | methyl N-[1-(2-fluoro-2-oxoethyl)-9H-fluoren-9-yl]carbamate |
|---|---|
| PubChem CID | 87287953 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | methyl N-[1-(2-fluoro-2-oxoethyl)-9H-fluoren-9-yl]carbamate |
| SMILES | COC(=O)NC1c2ccccc2-c2cccc(CC(=O)F)c21 |
| InChI | InChI=1S/C17H14FNO3/c1-22-17(21)19-16-13-7-3-2-6-11(13)12-8-4-5-10(15(12)16)9-14(18)20/h2-8,16H,9H2,1H3,(H,19,21) |
| InChIKey | ZYDPLWDCCQEVEK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|