C11H20O2 — CID 87292209
(E)-5-methoxy-6,6-dimethyloct-3-en-2-one (PubChem CID 87292209) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E)-5-methoxy-6,6-dimethyloct-3-en-2-one.
| Compound Name | (E)-5-methoxy-6,6-dimethyloct-3-en-2-one |
|---|---|
| PubChem CID | 87292209 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E)-5-methoxy-6,6-dimethyloct-3-en-2-one |
| SMILES | CCC(C)(C)C(/C=C/C(C)=O)OC |
| InChI | InChI=1S/C11H20O2/c1-6-11(3,4)10(13-5)8-7-9(2)12/h7-8,10H,6H2,1-5H3/b8-7+ |
| InChIKey | VSPRHEDWIUAQGF-BQYQJAHWSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|