C31H29F6N3O6S — CID 87293519
[7-[(1R)-2-[2-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]phenyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 87293519) has the molecular formula C31H29F6N3O6S and a molecular weight of 685.64 g/mol. Its IUPAC name is [7-[(1R)-2-[2-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]phenyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [7-[(1R)-2-[2-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]phenyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87293519 |
| Molecular Formula | C31H29F6N3O6S |
| Molecular Weight | 685.64 g/mol |
| Exact Mass | 685.17 |
| IUPAC Name | [7-[(1R)-2-[2-[3-[[2-(2-methoxyphenyl)ethylamino]methyl]phenyl]ethylamino]-1-(2,2,2-trifluoroacetyl)oxyethyl]-2-oxo-3H-1,3-benzothiazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1ccccc1CCNCc1cccc(CCNC[C@H](OC(=O)C(F)(F)F)c2ccc(OC(=O)C(F)(F)F)c3[nH]c(=O)sc23)c1 |
| InChI | InChI=1S/C31H29F6N3O6S/c1-44-22-8-3-2-7-20(22)12-14-38-16-19-6-4-5-18(15-19)11-13-39-17-24(46-28(42)31(35,36)37)21-9-10-23(45-27(41)30(32,33)34)25-26(21)47-29(43)40-25/h2-10,15,24,38-39H,11-14,16-17H2,1H3,(H,40,43)/t24-/m0/s1 |
| InChIKey | ZLFBFPGVCPKOTD-DEOSSOPVSA-N |
| XLogP | 5.38 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|