C10H8O6S3 — CID 87293580
8-sulfanylnaphthalene-1,3-disulfonic acid (PubChem CID 87293580) has the molecular formula C10H8O6S3 and a molecular weight of 320.37 g/mol. Its IUPAC name is 8-sulfanylnaphthalene-1,3-disulfonic acid.
| Compound Name | 8-sulfanylnaphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 87293580 |
| Molecular Formula | C10H8O6S3 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 8-sulfanylnaphthalene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)O)c2c(S)cccc2c1 |
| InChI | InChI=1S/C10H8O6S3/c11-18(12,13)7-4-6-2-1-3-8(17)10(6)9(5-7)19(14,15)16/h1-5,17H,(H,11,12,13)(H,14,15,16) |
| InChIKey | WHPWENJJWHGZLH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|