C13H24N4OS2 — CID 872977
1-cyclohexyl-3-[(2-thiomorpholin-4-ylacetyl)amino]thiourea (PubChem CID 872977) has the molecular formula C13H24N4OS2 and a molecular weight of 316.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2-thiomorpholin-4-ylacetyl)amino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(2-thiomorpholin-4-ylacetyl)amino]thiourea |
|---|---|
| PubChem CID | 872977 |
| Molecular Formula | C13H24N4OS2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-cyclohexyl-3-[(2-thiomorpholin-4-ylacetyl)amino]thiourea |
| SMILES | O=C(CN1CCSCC1)NNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C13H24N4OS2/c18-12(10-17-6-8-20-9-7-17)15-16-13(19)14-11-4-2-1-3-5-11/h11H,1-10H2,(H,15,18)(H2,14,16,19) |
| InChIKey | SKARGJDXMXQSEZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|