About [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate
[3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate (PubChem CID 87297743) has the molecular formula C17H15NO5S
and a molecular weight of 345.38 g/mol. Its IUPAC name is [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate.
Molecular Properties
| Compound Name | [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate |
| PubChem CID | 87297743 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(COC(=O)CC#N)c2)cc1 |
| InChI | InChI=1S/C17H15NO5S/c1-13-5-7-16(8-6-13)24(20,21)23-15-4-2-3-14(11-15)12-22-17(19)9-10-18/h2-8,11H,9,12H2,1H3 |
| InChIKey | VUOIZRUPMPNZPV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate?
The IUPAC name of [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate (CID 87297743) is [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate.
What is the SMILES notation for [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate?
The canonical SMILES for [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate is Cc1ccc(S(=O)(=O)Oc2cccc(COC(=O)CC#N)c2)cc1.
What is the InChIKey of [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate?
The InChIKey is VUOIZRUPMPNZPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO5S/c1-13-5-7-16(8-6-13)24(20,21)23-15-4-2-3-14(11-15)12-22-17(19)9-10-18/h2-8,11H,9,12H2,1H3.
What are the key properties of [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate?
[3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate has a molecular weight of 345.38 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methylphenyl)sulfonyloxyphenyl]methyl 2-cyanoacetate is sourced from PubChem (CID 87297743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).