C20H25NO5S — CID 87298355
propan-2-yl (2S)-2-(benzylamino)-3-(3-methylsulfonyloxyphenyl)propanoate (PubChem CID 87298355) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-(benzylamino)-3-(3-methylsulfonyloxyphenyl)propanoate.
| Compound Name | propan-2-yl (2S)-2-(benzylamino)-3-(3-methylsulfonyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 87298355 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | propan-2-yl (2S)-2-(benzylamino)-3-(3-methylsulfonyloxyphenyl)propanoate |
| SMILES | CC(C)OC(=O)[C@H](Cc1cccc(OS(C)(=O)=O)c1)NCc1ccccc1 |
| InChI | InChI=1S/C20H25NO5S/c1-15(2)25-20(22)19(21-14-16-8-5-4-6-9-16)13-17-10-7-11-18(12-17)26-27(3,23)24/h4-12,15,19,21H,13-14H2,1-3H3/t19-/m0/s1 |
| InChIKey | HGJWVFXDNFQMKL-IBGZPJMESA-N |
| XLogP | 2.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|