C13H29NO2 — CID 87298989
2,2-dimethylpropanoate;ethyl-di(propan-2-yl)azanium (PubChem CID 87298989) has the molecular formula C13H29NO2 and a molecular weight of 231.38 g/mol. Its IUPAC name is 2,2-dimethylpropanoate;ethyl-di(propan-2-yl)azanium.
| Compound Name | 2,2-dimethylpropanoate;ethyl-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 87298989 |
| Molecular Formula | C13H29NO2 |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.22 |
| IUPAC Name | 2,2-dimethylpropanoate;ethyl-di(propan-2-yl)azanium |
| SMILES | CC(C)(C)C(=O)[O-].CC[NH+](C(C)C)C(C)C |
| InChI | InChI=1S/C8H19N.C5H10O2/c1-6-9(7(2)3)8(4)5;1-5(2,3)4(6)7/h7-8H,6H2,1-5H3;1-3H3,(H,6,7) |
| InChIKey | GLCIIPGGAQEMMB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |