C17H37NO2 — CID 87523639
decyl(dimethyl)azanium;2,2-dimethylpropanoate (PubChem CID 87523639) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is decyl(dimethyl)azanium;2,2-dimethylpropanoate.
| Compound Name | decyl(dimethyl)azanium;2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87523639 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | decyl(dimethyl)azanium;2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)[O-].CCCCCCCCCC[NH+](C)C |
| InChI | InChI=1S/C12H27N.C5H10O2/c1-4-5-6-7-8-9-10-11-12-13(2)3;1-5(2,3)4(6)7/h4-12H2,1-3H3;1-3H3,(H,6,7) |
| InChIKey | VCWPIMCNDWYXTB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|