C25H21F7N2O — CID 87299284
5-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluorophenyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine (PubChem CID 87299284) has the molecular formula C25H21F7N2O and a molecular weight of 498.44 g/mol. Its IUPAC name is 5-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluorophenyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine.
| Compound Name | 5-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluorophenyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine |
|---|---|
| PubChem CID | 87299284 |
| Molecular Formula | C25H21F7N2O |
| Molecular Weight | 498.44 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 5-[1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-7-(4-fluorophenyl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]oxazocine |
| SMILES | CC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCCOc2nccc(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C25H21F7N2O/c1-15(17-11-18(24(27,28)29)13-19(12-17)25(30,31)32)34-9-2-10-35-23-22(14-34)21(7-8-33-23)16-3-5-20(26)6-4-16/h3-8,11-13,15H,2,9-10,14H2,1H3 |
| InChIKey | YOKRPDJYPWILAV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.44 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |