C13H22O5 — CID 87301256
2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one (PubChem CID 87301256) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one.
| Compound Name | 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 87301256 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2,2-diethyl-3-oxobutanoic acid;(Z)-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C(/C)O.CCC(CC)(C(C)=O)C(=O)O |
| InChI | InChI=1S/C8H14O3.C5H8O2/c1-4-8(5-2,6(3)9)7(10)11;1-4(6)3-5(2)7/h4-5H2,1-3H3,(H,10,11);3,6H,1-2H3/b;4-3- |
| InChIKey | SAOJPFNXXKHGGI-QGAMPUOQSA-N |
| XLogP | 2.50 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|