C17H14FN3O3S — CID 87301363
[3-[[5-cyano-4-(3-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]cyclopentyl] formate (PubChem CID 87301363) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is [3-[[5-cyano-4-(3-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]cyclopentyl] formate.
| Compound Name | [3-[[5-cyano-4-(3-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]cyclopentyl] formate |
|---|---|
| PubChem CID | 87301363 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | [3-[[5-cyano-4-(3-fluorophenyl)-1,3-thiazol-2-yl]carbamoyl]cyclopentyl] formate |
| SMILES | N#Cc1sc(NC(=O)C2CCC(OC=O)C2)nc1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H14FN3O3S/c18-12-3-1-2-10(6-12)15-14(8-19)25-17(20-15)21-16(23)11-4-5-13(7-11)24-9-22/h1-3,6,9,11,13H,4-5,7H2,(H,20,21,23) |
| InChIKey | QTIBHCTWNYVDND-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|