C28H33N3O5S — CID 87310125
N-[4-(3-ethylmorpholine-4-carbonyl)cyclohexyl]-3-formyl-2-phenyl-1H-indole-6-sulfonamide (PubChem CID 87310125) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-[4-(3-ethylmorpholine-4-carbonyl)cyclohexyl]-3-formyl-2-phenyl-1H-indole-6-sulfonamide.
| Compound Name | N-[4-(3-ethylmorpholine-4-carbonyl)cyclohexyl]-3-formyl-2-phenyl-1H-indole-6-sulfonamide |
|---|---|
| PubChem CID | 87310125 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[4-(3-ethylmorpholine-4-carbonyl)cyclohexyl]-3-formyl-2-phenyl-1H-indole-6-sulfonamide |
| SMILES | CCC1COCCN1C(=O)C1CCC(NS(=O)(=O)c2ccc3c(C=O)c(-c4ccccc4)[nH]c3c2)CC1 |
| InChI | InChI=1S/C28H33N3O5S/c1-2-22-18-36-15-14-31(22)28(33)20-8-10-21(11-9-20)30-37(34,35)23-12-13-24-25(17-32)27(29-26(24)16-23)19-6-4-3-5-7-19/h3-7,12-13,16-17,20-22,29-30H,2,8-11,14-15,18H2,1H3 |
| InChIKey | PRQLLGQKXAVTHD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|