C28H26N4O3S — CID 90096563
N-[4-(isoindole-2-carbonyl)cyclohexyl]-2-phenyl-3H-benzimidazole-5-sulfonamide (PubChem CID 90096563) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is N-[4-(isoindole-2-carbonyl)cyclohexyl]-2-phenyl-3H-benzimidazole-5-sulfonamide.
| Compound Name | N-[4-(isoindole-2-carbonyl)cyclohexyl]-2-phenyl-3H-benzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 90096563 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[4-(isoindole-2-carbonyl)cyclohexyl]-2-phenyl-3H-benzimidazole-5-sulfonamide |
| SMILES | O=C(C1CCC(NS(=O)(=O)c2ccc3nc(-c4ccccc4)[nH]c3c2)CC1)n1cc2ccccc2c1 |
| InChI | InChI=1S/C28H26N4O3S/c33-28(32-17-21-8-4-5-9-22(21)18-32)20-10-12-23(13-11-20)31-36(34,35)24-14-15-25-26(16-24)30-27(29-25)19-6-2-1-3-7-19/h1-9,14-18,20,23,31H,10-13H2,(H,29,30) |
| InChIKey | NVXAQGKDULQAMA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |